C16H19F3N4O2 — CID 156539968
tert-butyl 4-methyl-13-(trifluoromethyl)-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-10-carboxylate (PubChem CID 156539968) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is tert-butyl 4-methyl-13-(trifluoromethyl)-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-10-carboxylate.
| Compound Name | tert-butyl 4-methyl-13-(trifluoromethyl)-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 156539968 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl 4-methyl-13-(trifluoromethyl)-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene-10-carboxylate |
| SMILES | Cc1cc2ncc3c(n2n1)C(C(F)(F)F)CCN3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19F3N4O2/c1-9-7-12-20-8-11-13(23(12)21-9)10(16(17,18)19)5-6-22(11)14(24)25-15(2,3)4/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | ASMCMBLVZLKYSC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |