C9H7ClN4O — CID 156540165
12-chloro-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-3-one (PubChem CID 156540165) has the molecular formula C9H7ClN4O and a molecular weight of 222.63 g/mol. Its IUPAC name is 12-chloro-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-3-one.
| Compound Name | 12-chloro-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-3-one |
|---|---|
| PubChem CID | 156540165 |
| Molecular Formula | C9H7ClN4O |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 12-chloro-4,8,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-3-one |
| SMILES | O=C1NCCc2[nH]c3nnc(Cl)cc3c21 |
| InChI | InChI=1S/C9H7ClN4O/c10-6-3-4-7-5(1-2-11-9(7)15)12-8(4)14-13-6/h3H,1-2H2,(H,11,15)(H,12,14) |
| InChIKey | ZWVCWKQPVJPCSA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |