C25H35BrN2O4 — CID 156540319
3-[5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 156540319) has the molecular formula C25H35BrN2O4 and a molecular weight of 507.47 g/mol. Its IUPAC name is 3-[5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 156540319 |
| Molecular Formula | C25H35BrN2O4 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 3-[5-[1-[[(E)-3-(2-bromophenyl)-4-methoxy-4-oxobut-2-en-2-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | COC(=O)/C(=C(\C)NC(C)C1CC2CN(CC(C)(C)C(=O)O)CC2C1)c1ccccc1Br |
| InChI | InChI=1S/C25H35BrN2O4/c1-15(27-16(2)22(23(29)32-5)20-8-6-7-9-21(20)26)17-10-18-12-28(13-19(18)11-17)14-25(3,4)24(30)31/h6-9,15,17-19,27H,10-14H2,1-5H3,(H,30,31)/b22-16+ |
| InChIKey | ZEPZWMCLRXUMEK-CJLVFECKSA-N |
| XLogP | 4.40 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|