About methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate
methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate (PubChem CID 156540976) has the molecular formula C17H18F3N3O2
and a molecular weight of 353.34 g/mol. Its IUPAC name is methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate |
| PubChem CID | 156540976 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cc1cccc(-c2cc(C(F)(F)F)nc(N)n2)c1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-16(2,14(24)25-3)9-10-5-4-6-11(7-10)12-8-13(17(18,19)20)23-15(21)22-12/h4-8H,9H2,1-3H3,(H2,21,22,23) |
| InChIKey | LENXNKYBDMEMQS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate (CID 156540976) is methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate is COC(=O)C(C)(C)Cc1cccc(-c2cc(C(F)(F)F)nc(N)n2)c1.
What is the InChIKey of methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate?
The InChIKey is LENXNKYBDMEMQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3N3O2/c1-16(2,14(24)25-3)9-10-5-4-6-11(7-10)12-8-13(17(18,19)20)23-15(21)22-12/h4-8H,9H2,1-3H3,(H2,21,22,23).
What are the key properties of methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate?
methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate has a molecular weight of 353.34 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]-2,2-dimethylpropanoate is sourced from PubChem (CID 156540976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).