About 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid
3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid (PubChem CID 156541291) has the molecular formula C16H17FN2O2
and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid |
| PubChem CID | 156541291 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1ccc(F)c(-c2cccc(N)n2)c1)C(=O)O |
| InChI | InChI=1S/C16H17FN2O2/c1-16(2,15(20)21)9-10-6-7-12(17)11(8-10)13-4-3-5-14(18)19-13/h3-8H,9H2,1-2H3,(H2,18,19)(H,20,21) |
| InChIKey | XWBRORIWYCHIDR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid (CID 156541291) is 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid is CC(C)(Cc1ccc(F)c(-c2cccc(N)n2)c1)C(=O)O.
What is the InChIKey of 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid?
The InChIKey is XWBRORIWYCHIDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O2/c1-16(2,15(20)21)9-10-6-7-12(17)11(8-10)13-4-3-5-14(18)19-13/h3-8H,9H2,1-2H3,(H2,18,19)(H,20,21).
What are the key properties of 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid?
3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid has a molecular weight of 288.32 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 156541291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).