C28H22ClN7S2 — CID 156542019
(9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 156542019) has the molecular formula C28H22ClN7S2 and a molecular weight of 556.12 g/mol. Its IUPAC name is (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 156542019 |
| Molecular Formula | C28H22ClN7S2 |
| Molecular Weight | 556.12 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | (9S)-7-(4-chlorophenyl)-5,13-dimethyl-9-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-4-(2-pyridin-2-ylethynyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc(CC[C@@H]2N=C(c3ccc(Cl)cc3)c3c(sc(C#Cc4ccccn4)c3C)-n3c(C)nnc32)s1 |
| InChI | InChI=1S/C28H22ClN7S2/c1-16-23(13-11-21-6-4-5-15-30-21)38-28-25(16)26(19-7-9-20(29)10-8-19)31-22(27-35-32-17(2)36(27)28)12-14-24-34-33-18(3)37-24/h4-10,15,22H,12,14H2,1-3H3/t22-/m0/s1 |
| InChIKey | IWVCRGPEQXOOSY-QFIPXVFZSA-N |
| XLogP | 6.08 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.12 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|