C22H31F2N5O5 — CID 156542772
[1-[[(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-5,5-difluoropiperidin-2-yl]-ethoxymethanol (PubChem CID 156542772) has the molecular formula C22H31F2N5O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is [1-[[(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-5,5-difluoropiperidin-2-yl]-ethoxymethanol.
| Compound Name | [1-[[(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-5,5-difluoropiperidin-2-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 156542772 |
| Molecular Formula | C22H31F2N5O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | [1-[[(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-5,5-difluoropiperidin-2-yl]-ethoxymethanol |
| SMILES | CCOC(O)C1CCC(F)(F)CN1C[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H31F2N5O5/c1-4-31-20(30)13-5-7-22(23,24)10-28(13)9-14-15-16(34-21(2,3)33-15)19(32-14)29-8-6-12-17(25)26-11-27-18(12)29/h6,8,11,13-16,19-20,30H,4-5,7,9-10H2,1-3H3,(H2,25,26,27)/t13?,14-,15-,16-,19-,20?/m1/s1 |
| InChIKey | SNCNOLYGFXKXSN-UUMXHZSTSA-N |
| XLogP | 1.89 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|