C9H14FN — CID 156542875
(3Z,5E)-6-fluoro-N,N-dimethylhepta-1,3,5-trien-2-amine (PubChem CID 156542875) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is (3Z,5E)-6-fluoro-N,N-dimethylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-6-fluoro-N,N-dimethylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 156542875 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (3Z,5E)-6-fluoro-N,N-dimethylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C=C(/C)F)N(C)C |
| InChI | InChI=1S/C9H14FN/c1-8(10)6-5-7-9(2)11(3)4/h5-7H,2H2,1,3-4H3/b7-5-,8-6+ |
| InChIKey | GWARXGOUGJLNRU-CGXWXWIYSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|