C26H40F2N6O5 — CID 156542927
tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropyrrolidin-2-yl]ethyl]carbamate (PubChem CID 156542927) has the molecular formula C26H40F2N6O5 and a molecular weight of 554.64 g/mol. Its IUPAC name is tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropyrrolidin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropyrrolidin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 156542927 |
| Molecular Formula | C26H40F2N6O5 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | tert-butyl N-[2-[(2R)-1-[[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-(2-hydroxypropan-2-yloxy)-3-methyloxolan-2-yl]methyl]-4,4-difluoropyrrolidin-2-yl]ethyl]carbamate |
| SMILES | C[C@H]1[C@@H](OC(C)(C)O)[C@H](c2ccc3c(N)ncnn23)O[C@@H]1CN1CC(F)(F)C[C@H]1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40F2N6O5/c1-15-19(12-33-13-26(27,28)11-16(33)9-10-30-23(35)39-24(2,3)4)37-21(20(15)38-25(5,6)36)17-7-8-18-22(29)31-14-32-34(17)18/h7-8,14-16,19-21,36H,9-13H2,1-6H3,(H,30,35)(H2,29,31,32)/t15-,16-,19-,20-,21+/m1/s1 |
| InChIKey | RPFDCDINAQWCBN-VQDSBOJYSA-N |
| XLogP | 3.13 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|