C18H33FN2 — CID 156543123
(2Z,4Z)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-6-fluoronona-2,4-dien-1-amine (PubChem CID 156543123) has the molecular formula C18H33FN2 and a molecular weight of 296.47 g/mol. Its IUPAC name is (2Z,4Z)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-6-fluoronona-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-6-fluoronona-2,4-dien-1-amine |
|---|---|
| PubChem CID | 156543123 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | (2Z,4Z)-N-[2-(1-ethylpiperidin-4-yl)ethyl]-6-fluoronona-2,4-dien-1-amine |
| SMILES | CCCC(F)/C=C\C=C/CNCCC1CCN(CC)CC1 |
| InChI | InChI=1S/C18H33FN2/c1-3-8-18(19)9-6-5-7-13-20-14-10-17-11-15-21(4-2)16-12-17/h5-7,9,17-18,20H,3-4,8,10-16H2,1-2H3/b7-5-,9-6- |
| InChIKey | DRFVYSWCBAKOEH-BSIYMUDXSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|