C16H19F3N2 — CID 156543765
(2Z,4E)-5-(3-azabicyclo[3.1.1]heptan-3-yl)-2-prop-1-en-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile (PubChem CID 156543765) has the molecular formula C16H19F3N2 and a molecular weight of 296.34 g/mol. Its IUPAC name is (2Z,4E)-5-(3-azabicyclo[3.1.1]heptan-3-yl)-2-prop-1-en-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-(3-azabicyclo[3.1.1]heptan-3-yl)-2-prop-1-en-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 156543765 |
| Molecular Formula | C16H19F3N2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2Z,4E)-5-(3-azabicyclo[3.1.1]heptan-3-yl)-2-prop-1-en-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile |
| SMILES | C=C(C)/C(C#N)=C(\C=C(/C)N1CC2CC(C2)C1)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2/c1-10(2)14(7-20)15(16(17,18)19)4-11(3)21-8-12-5-13(6-12)9-21/h4,12-13H,1,5-6,8-9H2,2-3H3/b11-4+,15-14+ |
| InChIKey | OLFXXNWSRVEGCG-GKVQQRSZSA-N |
| XLogP | 4.19 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|