About 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine
1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine (PubChem CID 156544140) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine |
| PubChem CID | 156544140 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine |
| SMILES | CC/C=C(\N=C(/C)C1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-3-10-18(17-13-8-5-9-14-17)19-15(2)16-11-6-4-7-12-16/h4-6,8-11,13-14H,3,7,12H2,1-2H3/b18-10-,19-15+ |
| InChIKey | AKMNWNZGTRFOQK-MJOUMNEMSA-N |
| XLogP | 5.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine (CID 156544140) is 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine is CC/C=C(\N=C(/C)C1=CC=CCC1)c1ccccc1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine?
The InChIKey is AKMNWNZGTRFOQK-MJOUMNEMSA-N. The full InChI is InChI=1S/C18H21N/c1-3-10-18(17-13-8-5-9-14-17)19-15(2)16-11-6-4-7-12-16/h4-6,8-11,13-14H,3,7,12H2,1-2H3/b18-10-,19-15+.
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine?
1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine has a molecular weight of 251.37 g/mol, XLogP of 5.17, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-N-[(Z)-1-phenylbut-1-enyl]ethanimine is sourced from PubChem (CID 156544140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).