About N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine
N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine (PubChem CID 156544388) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine.
Molecular Properties
| Compound Name | N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine |
| PubChem CID | 156544388 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine |
| SMILES | C/C=C(\CC)CNCNCC |
| InChI | InChI=1S/C9H20N2/c1-4-9(5-2)7-11-8-10-6-3/h4,10-11H,5-8H2,1-3H3/b9-4+ |
| InChIKey | QGFAANKNIMRKJI-RUDMXATFSA-N |
| XLogP | 1.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine?
The IUPAC name of N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine (CID 156544388) is N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine.
What is the SMILES notation for N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine?
The canonical SMILES for N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine is C/C=C(\CC)CNCNCC.
What is the InChIKey of N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine?
The InChIKey is QGFAANKNIMRKJI-RUDMXATFSA-N. The full InChI is InChI=1S/C9H20N2/c1-4-9(5-2)7-11-8-10-6-3/h4,10-11H,5-8H2,1-3H3/b9-4+.
What are the key properties of N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine?
N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine has a molecular weight of 156.27 g/mol, XLogP of 1.50, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[(E)-2-ethylbut-2-enyl]methanediamine is sourced from PubChem (CID 156544388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).