About (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine
(E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine (PubChem CID 156544458) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine.
Molecular Properties
| Compound Name | (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine |
| PubChem CID | 156544458 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine |
| SMILES | [H]/N=C(\C)C/C(CN(C)CCCC/C=C(\C)CCC)=N\[H] |
| InChI | InChI=1S/C16H31N3/c1-5-9-14(2)10-7-6-8-11-19(4)13-16(18)12-15(3)17/h10,17-18H,5-9,11-13H2,1-4H3/b14-10+,17-15+,18-16+ |
| InChIKey | NJFHOZZOPZEILB-LHLAJSEZSA-N |
| XLogP | 4.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine?
The IUPAC name of (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine (CID 156544458) is (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine.
What is the SMILES notation for (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine?
The canonical SMILES for (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine is [H]/N=C(\C)C/C(CN(C)CCCC/C=C(\C)CCC)=N\[H].
What is the InChIKey of (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine?
The InChIKey is NJFHOZZOPZEILB-LHLAJSEZSA-N. The full InChI is InChI=1S/C16H31N3/c1-5-9-14(2)10-7-6-8-11-19(4)13-16(18)12-15(3)17/h10,17-18H,5-9,11-13H2,1-4H3/b14-10+,17-15+,18-16+.
What are the key properties of (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine?
(E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine has a molecular weight of 265.44 g/mol, XLogP of 4.28, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,4-diiminopentyl)-N,6-dimethylnon-5-en-1-amine is sourced from PubChem (CID 156544458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).