C7H13N3O2 — CID 156544693
2-(2,5,7-triazabicyclo[4.2.0]octan-2-yl)acetic acid (PubChem CID 156544693) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(2,5,7-triazabicyclo[4.2.0]octan-2-yl)acetic acid.
| Compound Name | 2-(2,5,7-triazabicyclo[4.2.0]octan-2-yl)acetic acid |
|---|---|
| PubChem CID | 156544693 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-(2,5,7-triazabicyclo[4.2.0]octan-2-yl)acetic acid |
| SMILES | O=C(O)CN1CCNC2NCC21 |
| InChI | InChI=1S/C7H13N3O2/c11-6(12)4-10-2-1-8-7-5(10)3-9-7/h5,7-9H,1-4H2,(H,11,12) |
| InChIKey | DYUOKFBLOSHCOP-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |