C26H28FN — CID 156544756
1-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-8-fluoro-12-methyl-1,2,6a,10a,11,12-hexahydronaphtho[2,1-f]isoquinoline (PubChem CID 156544756) has the molecular formula C26H28FN and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-8-fluoro-12-methyl-1,2,6a,10a,11,12-hexahydronaphtho[2,1-f]isoquinoline.
| Compound Name | 1-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-8-fluoro-12-methyl-1,2,6a,10a,11,12-hexahydronaphtho[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 156544756 |
| Molecular Formula | C26H28FN |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 1-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-8-fluoro-12-methyl-1,2,6a,10a,11,12-hexahydronaphtho[2,1-f]isoquinoline |
| SMILES | CC1=CC(C)CC(C2NC=CC3=C2C(C)CC2=C3C=CC3C=C(F)C=CC23)=C1 |
| InChI | InChI=1S/C26H28FN/c1-15-10-16(2)12-19(11-15)26-25-17(3)13-24-21-7-5-20(27)14-18(21)4-6-22(24)23(25)8-9-28-26/h4-11,14,16-18,21,26,28H,12-13H2,1-3H3 |
| InChIKey | JWDUYPQIVGUSBM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |