C23H32FN3 — CID 156544884
(2E,4Z,6E)-N-[[3-[(1E,3E)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methyl-4H-pyrimidin-6-yl]methyl]-7-fluoro-N-methylhepta-2,4,6-trien-3-amine (PubChem CID 156544884) has the molecular formula C23H32FN3 and a molecular weight of 369.53 g/mol. Its IUPAC name is (2E,4Z,6E)-N-[[3-[(1E,3E)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methyl-4H-pyrimidin-6-yl]methyl]-7-fluoro-N-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6E)-N-[[3-[(1E,3E)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methyl-4H-pyrimidin-6-yl]methyl]-7-fluoro-N-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 156544884 |
| Molecular Formula | C23H32FN3 |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | (2E,4Z,6E)-N-[[3-[(1E,3E)-2-ethenyl-3-methylhexa-1,3-dienyl]-2-methyl-4H-pyrimidin-6-yl]methyl]-7-fluoro-N-methylhepta-2,4,6-trien-3-amine |
| SMILES | C=CC(=C\N1CC=C(CN(C)C(/C=C\C=C\F)=C/C)N=C1C)/C(C)=C/CC |
| InChI | InChI=1S/C23H32FN3/c1-7-12-19(4)21(8-2)17-27-16-14-22(25-20(27)5)18-26(6)23(9-3)13-10-11-15-24/h8-15,17H,2,7,16,18H2,1,3-6H3/b13-10-,15-11+,19-12+,21-17+,23-9+ |
| InChIKey | OGTPXEWTSNXZHH-JGVNTLIUSA-N |
| XLogP | 5.91 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|