C23H27N7 — CID 15654568
(4R,12R)-4-N,12-N-bis(4,5-dihydro-1H-imidazol-2-yl)-8-phenyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,12-diamine (PubChem CID 15654568) has the molecular formula C23H27N7 and a molecular weight of 401.52 g/mol. Its IUPAC name is (4R,12R)-4-N,12-N-bis(4,5-dihydro-1H-imidazol-2-yl)-8-phenyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,12-diamine.
| Compound Name | (4R,12R)-4-N,12-N-bis(4,5-dihydro-1H-imidazol-2-yl)-8-phenyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,12-diamine |
|---|---|
| PubChem CID | 15654568 |
| Molecular Formula | C23H27N7 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (4R,12R)-4-N,12-N-bis(4,5-dihydro-1H-imidazol-2-yl)-8-phenyl-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene-4,12-diamine |
| SMILES | c1ccc(-c2c3c(nc4c2CC[C@H]4NC2=NCCN2)[C@H](NC2=NCCN2)CC3)cc1 |
| InChI | InChI=1S/C23H27N7/c1-2-4-14(5-3-1)19-15-6-8-17(28-22-24-10-11-25-22)20(15)30-21-16(19)7-9-18(21)29-23-26-12-13-27-23/h1-5,17-18H,6-13H2,(H2,24,25,28)(H2,26,27,29)/t17-,18-/m1/s1 |
| InChIKey | HNUOOSZHOXTPMS-QZTJIDSGSA-N |
| XLogP | 1.82 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |