C21H37F2N2O6P — CID 156545695
tert-butyl 2-diethoxyphosphoryl-3-[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 156545695) has the molecular formula C21H37F2N2O6P and a molecular weight of 482.51 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 156545695 |
| Molecular Formula | C21H37F2N2O6P |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-[3-(8,8-difluorooctyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | CCOP(=O)(OCC)C(Cc1nc(CCCCCCCC(F)F)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37F2N2O6P/c1-6-28-32(27,29-7-2)16(20(26)30-21(3,4)5)15-19-24-18(25-31-19)14-12-10-8-9-11-13-17(22)23/h16-17H,6-15H2,1-5H3 |
| InChIKey | QNZHMZMSWZKFHL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|