About 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine
8-bromo-3-(trifluoromethyl)-1,5-naphthyridine (PubChem CID 15654587) has the molecular formula C9H4BrF3N2
and a molecular weight of 277.04 g/mol. Its IUPAC name is 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine.
Molecular Properties
| Compound Name | 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine |
| PubChem CID | 15654587 |
| Molecular Formula | C9H4BrF3N2 |
| Molecular Weight | 277.04 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine |
| SMILES | FC(F)(F)c1cnc2c(Br)ccnc2c1 |
| InChI | InChI=1S/C9H4BrF3N2/c10-6-1-2-14-7-3-5(9(11,12)13)4-15-8(6)7/h1-4H |
| InChIKey | LGOBJQIULVLTCV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.04 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine?
The IUPAC name of 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine (CID 15654587) is 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine.
What is the SMILES notation for 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine?
The canonical SMILES for 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine is FC(F)(F)c1cnc2c(Br)ccnc2c1.
What is the InChIKey of 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine?
The InChIKey is LGOBJQIULVLTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrF3N2/c10-6-1-2-14-7-3-5(9(11,12)13)4-15-8(6)7/h1-4H.
What are the key properties of 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine?
8-bromo-3-(trifluoromethyl)-1,5-naphthyridine has a molecular weight of 277.04 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-(trifluoromethyl)-1,5-naphthyridine is sourced from PubChem (CID 15654587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).