C22H24F5N3O4 — CID 156545939
(2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 156545939) has the molecular formula C22H24F5N3O4 and a molecular weight of 489.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 156545939 |
| Molecular Formula | C22H24F5N3O4 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | CC[C@H]1[C@@H](c2ccc(F)c(F)c2OC)[C@H](C(=O)Nc2ccnc(C(N)O)c2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C22H24F5N3O4/c1-4-12-15(11-5-6-13(23)16(24)17(11)33-3)18(34-21(12,2)22(25,26)27)20(32)30-10-7-8-29-14(9-10)19(28)31/h5-9,12,15,18-19,31H,4,28H2,1-3H3,(H,29,30,32)/t12-,15+,18+,19?,21+/m0/s1 |
| InChIKey | JRYKWAAQONQOLV-ZIBKOOJSSA-N |
| XLogP | 3.79 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|