C5H2F3N5O5 — CID 15654617
N-(1,4-dinitropyrazol-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 15654617) has the molecular formula C5H2F3N5O5 and a molecular weight of 269.10 g/mol. Its IUPAC name is N-(1,4-dinitropyrazol-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1,4-dinitropyrazol-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 15654617 |
| Molecular Formula | C5H2F3N5O5 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | N-(1,4-dinitropyrazol-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1nn([N+](=O)[O-])cc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C5H2F3N5O5/c6-5(7,8)4(14)9-3-2(12(15)16)1-11(10-3)13(17)18/h1H,(H,9,10,14) |
| InChIKey | SOQIFDBIPKDSKZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|