About 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol
1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol (PubChem CID 156547545) has the molecular formula C9H19F2NO
and a molecular weight of 195.25 g/mol. Its IUPAC name is 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol |
| PubChem CID | 156547545 |
| Molecular Formula | C9H19F2NO |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)C(F)(F)C(C)(O)CN(C)C |
| InChI | InChI=1S/C9H19F2NO/c1-7(2)9(10,11)8(3,13)6-12(4)5/h7,13H,6H2,1-5H3 |
| InChIKey | GTIDWIJMRCDINV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol?
The IUPAC name of 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol (CID 156547545) is 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol?
The canonical SMILES for 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol is CC(C)C(F)(F)C(C)(O)CN(C)C.
What is the InChIKey of 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol?
The InChIKey is GTIDWIJMRCDINV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F2NO/c1-7(2)9(10,11)8(3,13)6-12(4)5/h7,13H,6H2,1-5H3.
What are the key properties of 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol?
1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol has a molecular weight of 195.25 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-3,3-difluoro-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 156547545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).