About 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one
3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one (PubChem CID 156547561) has the molecular formula C9H15F2NOS
and a molecular weight of 223.29 g/mol. Its IUPAC name is 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one |
| PubChem CID | 156547561 |
| Molecular Formula | C9H15F2NOS |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one |
| SMILES | CSC1C(C)C(CF)(CF)C(=O)N1C |
| InChI | InChI=1S/C9H15F2NOS/c1-6-7(14-3)12(2)8(13)9(6,4-10)5-11/h6-7H,4-5H2,1-3H3 |
| InChIKey | DAUIFGCPSGEKQA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one?
The IUPAC name of 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one (CID 156547561) is 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one.
What is the SMILES notation for 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one?
The canonical SMILES for 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one is CSC1C(C)C(CF)(CF)C(=O)N1C.
What is the InChIKey of 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one?
The InChIKey is DAUIFGCPSGEKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NOS/c1-6-7(14-3)12(2)8(13)9(6,4-10)5-11/h6-7H,4-5H2,1-3H3.
What are the key properties of 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one?
3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one has a molecular weight of 223.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(fluoromethyl)-1,4-dimethyl-5-methylsulfanylpyrrolidin-2-one is sourced from PubChem (CID 156547561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).