About 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine
1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine (PubChem CID 156547746) has the molecular formula C10H11F3IN
and a molecular weight of 329.10 g/mol. Its IUPAC name is 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine.
Molecular Properties
| Compound Name | 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine |
| PubChem CID | 156547746 |
| Molecular Formula | C10H11F3IN |
| Molecular Weight | 329.10 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine |
| SMILES | CC(F)(F)c1cccc(C(C)(N)I)c1F |
| InChI | InChI=1S/C10H11F3IN/c1-9(12,13)6-4-3-5-7(8(6)11)10(2,14)15/h3-5H,15H2,1-2H3 |
| InChIKey | JAKMRCASWXJWNK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine?
The IUPAC name of 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine (CID 156547746) is 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine.
What is the SMILES notation for 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine?
The canonical SMILES for 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine is CC(F)(F)c1cccc(C(C)(N)I)c1F.
What is the InChIKey of 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine?
The InChIKey is JAKMRCASWXJWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3IN/c1-9(12,13)6-4-3-5-7(8(6)11)10(2,14)15/h3-5H,15H2,1-2H3.
What are the key properties of 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine?
1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine has a molecular weight of 329.10 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1,1-difluoroethyl)-2-fluorophenyl]-1-iodoethanamine is sourced from PubChem (CID 156547746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).