C29H34F3N5O3 — CID 156547861
1,1-difluoro-1-[2-fluoro-3-[(1R)-1-[(2,8,8-trimethyl-7-morpholin-4-ylpyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol (PubChem CID 156547861) has the molecular formula C29H34F3N5O3 and a molecular weight of 557.62 g/mol. Its IUPAC name is 1,1-difluoro-1-[2-fluoro-3-[(1R)-1-[(2,8,8-trimethyl-7-morpholin-4-ylpyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol.
| Compound Name | 1,1-difluoro-1-[2-fluoro-3-[(1R)-1-[(2,8,8-trimethyl-7-morpholin-4-ylpyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 156547861 |
| Molecular Formula | C29H34F3N5O3 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1,1-difluoro-1-[2-fluoro-3-[(1R)-1-[(2,8,8-trimethyl-7-morpholin-4-ylpyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)(F)C(C)(C)O)c2F)c2cc3c(cc2n1)OC(C)(C)C(N1CCOCC1)=N3 |
| InChI | InChI=1S/C29H34F3N5O3/c1-16(18-8-7-9-20(24(18)30)29(31,32)28(5,6)38)33-25-19-14-22-23(15-21(19)34-17(2)35-25)40-27(3,4)26(36-22)37-10-12-39-13-11-37/h7-9,14-16,38H,10-13H2,1-6H3,(H,33,34,35)/t16-/m1/s1 |
| InChIKey | QMEQHXPGAAKFCJ-MRXNPFEDSA-N |
| XLogP | 5.65 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |