About 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine
6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine (PubChem CID 156547993) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine |
| PubChem CID | 156547993 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine |
| SMILES | C=C(CC)c1cc2c(cc1[N+](=O)[O-])OCC(=C)N2C |
| InChI | InChI=1S/C14H16N2O3/c1-5-9(2)11-6-13-14(7-12(11)16(17)18)19-8-10(3)15(13)4/h6-7H,2-3,5,8H2,1,4H3 |
| InChIKey | BTFNFRXPFDPLOR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine?
The IUPAC name of 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine (CID 156547993) is 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine.
What is the SMILES notation for 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine?
The canonical SMILES for 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine is C=C(CC)c1cc2c(cc1[N+](=O)[O-])OCC(=C)N2C.
What is the InChIKey of 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine?
The InChIKey is BTFNFRXPFDPLOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-5-9(2)11-6-13-14(7-12(11)16(17)18)19-8-10(3)15(13)4/h6-7H,2-3,5,8H2,1,4H3.
What are the key properties of 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine?
6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine has a molecular weight of 260.29 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-but-1-en-2-yl-4-methyl-3-methylidene-7-nitro-1,4-benzoxazine is sourced from PubChem (CID 156547993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).