C14H20O9 — CID 156548372
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(2,4,6-trihydroxyphenyl)ethoxy]oxane-3,4,5-triol (PubChem CID 156548372) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(2,4,6-trihydroxyphenyl)ethoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(2,4,6-trihydroxyphenyl)ethoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 156548372 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(2,4,6-trihydroxyphenyl)ethoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](OCCc2c(O)cc(O)cc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20O9/c15-5-10-11(19)12(20)13(21)14(23-10)22-2-1-7-8(17)3-6(16)4-9(7)18/h3-4,10-21H,1-2,5H2/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | XYFABIVSGXZKJT-RKQHYHRCSA-N |
| XLogP | -1.84 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |