C17H27N3O — CID 156548373
2-N-ethenyl-5-(1-ethoxyethenyl)-1-N,2-N-dimethyl-1-N-propan-2-ylbenzene-1,2,4-triamine (PubChem CID 156548373) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-N-ethenyl-5-(1-ethoxyethenyl)-1-N,2-N-dimethyl-1-N-propan-2-ylbenzene-1,2,4-triamine.
| Compound Name | 2-N-ethenyl-5-(1-ethoxyethenyl)-1-N,2-N-dimethyl-1-N-propan-2-ylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 156548373 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-N-ethenyl-5-(1-ethoxyethenyl)-1-N,2-N-dimethyl-1-N-propan-2-ylbenzene-1,2,4-triamine |
| SMILES | C=CN(C)c1cc(N)c(C(=C)OCC)cc1N(C)C(C)C |
| InChI | InChI=1S/C17H27N3O/c1-8-19(6)16-11-15(18)14(13(5)21-9-2)10-17(16)20(7)12(3)4/h8,10-12H,1,5,9,18H2,2-4,6-7H3 |
| InChIKey | LPCVRKHTFOZJIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|