About [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol
[(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol (PubChem CID 156548964) has the molecular formula C24H27NO3
and a molecular weight of 377.48 g/mol. Its IUPAC name is [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol.
Molecular Properties
| Compound Name | [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol |
| PubChem CID | 156548964 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol |
| SMILES | OC[C@H]1OCCN(Cc2cccc3ccccc23)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c26-17-24-23(28-18-19-7-2-1-3-8-19)16-25(13-14-27-24)15-21-11-6-10-20-9-4-5-12-22(20)21/h1-12,23-24,26H,13-18H2/t23-,24+/m0/s1 |
| InChIKey | GRZJIYOIRRENNV-BJKOFHAPSA-N |
| XLogP | 3.62 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol?
The IUPAC name of [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol (CID 156548964) is [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol.
What is the SMILES notation for [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol?
The canonical SMILES for [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol is OC[C@H]1OCCN(Cc2cccc3ccccc23)C[C@@H]1OCc1ccccc1.
What is the InChIKey of [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol?
The InChIKey is GRZJIYOIRRENNV-BJKOFHAPSA-N. The full InChI is InChI=1S/C24H27NO3/c26-17-24-23(28-18-19-7-2-1-3-8-19)16-25(13-14-27-24)15-21-11-6-10-20-9-4-5-12-22(20)21/h1-12,23-24,26H,13-18H2/t23-,24+/m0/s1.
What are the key properties of [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol?
[(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol has a molecular weight of 377.48 g/mol, XLogP of 3.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S,7R)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepan-7-yl]methanol is sourced from PubChem (CID 156548964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).