C15H17NO2S — CID 156549182
3,7-dimethyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline-5-sulfinic acid (PubChem CID 156549182) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 3,7-dimethyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline-5-sulfinic acid.
| Compound Name | 3,7-dimethyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline-5-sulfinic acid |
|---|---|
| PubChem CID | 156549182 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3,7-dimethyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline-5-sulfinic acid |
| SMILES | Cc1cc2c(S(=O)O)cc3c(c2cn1)CCCC3C |
| InChI | InChI=1S/C15H17NO2S/c1-9-4-3-5-11-12(9)7-15(19(17)18)13-6-10(2)16-8-14(11)13/h6-9H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | DKZLENDJKPKMSZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|