C13H9N3O5S2 — CID 15654935
5-(8-hydroxyquinolin-5-yl)sulfonyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 15654935) has the molecular formula C13H9N3O5S2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 5-(8-hydroxyquinolin-5-yl)sulfonyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(8-hydroxyquinolin-5-yl)sulfonyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 15654935 |
| Molecular Formula | C13H9N3O5S2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 5-(8-hydroxyquinolin-5-yl)sulfonyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1S(=O)(=O)c1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C13H9N3O5S2/c17-7-3-4-8(6-2-1-5-14-9(6)7)23(20,21)10-11(18)15-13(22)16-12(10)19/h1-5,10,17H,(H2,15,16,18,19,22) |
| InChIKey | ZLSLCSURYLYFSL-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|