C23H28FN5O5S — CID 156549449
N-(4-acetamidopiperidin-1-yl)sulfonyl-2-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)amino]-1,3-oxazole-4-carboxamide (PubChem CID 156549449) has the molecular formula C23H28FN5O5S and a molecular weight of 505.57 g/mol. Its IUPAC name is N-(4-acetamidopiperidin-1-yl)sulfonyl-2-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)amino]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-acetamidopiperidin-1-yl)sulfonyl-2-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)amino]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 156549449 |
| Molecular Formula | C23H28FN5O5S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N-(4-acetamidopiperidin-1-yl)sulfonyl-2-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)amino]-1,3-oxazole-4-carboxamide |
| SMILES | CC(=O)NC1CCN(S(=O)(=O)NC(=O)c2coc(Nc3c4c(c(F)c5c3CCC5)CCC4)n2)CC1 |
| InChI | InChI=1S/C23H28FN5O5S/c1-13(30)25-14-8-10-29(11-9-14)35(32,33)28-22(31)19-12-34-23(26-19)27-21-17-6-2-4-15(17)20(24)16-5-3-7-18(16)21/h12,14H,2-11H2,1H3,(H,25,30)(H,26,27)(H,28,31) |
| InChIKey | VCDYVFRFFBOBFE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |