About (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane
(6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane (PubChem CID 156549500) has the molecular formula C26H31NO3
and a molecular weight of 405.54 g/mol. Its IUPAC name is (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane.
Molecular Properties
| Compound Name | (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane |
| PubChem CID | 156549500 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane |
| SMILES | CCOC[C@H]1OCCN(Cc2cccc3ccccc23)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H31NO3/c1-2-28-20-26-25(30-19-21-9-4-3-5-10-21)18-27(15-16-29-26)17-23-13-8-12-22-11-6-7-14-24(22)23/h3-14,25-26H,2,15-20H2,1H3/t25-,26+/m0/s1 |
| InChIKey | LSEQIPTTZHVAKC-IZZNHLLZSA-N |
| XLogP | 4.66 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane?
The IUPAC name of (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane (CID 156549500) is (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane.
What is the SMILES notation for (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane?
The canonical SMILES for (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane is CCOC[C@H]1OCCN(Cc2cccc3ccccc23)C[C@@H]1OCc1ccccc1.
What is the InChIKey of (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane?
The InChIKey is LSEQIPTTZHVAKC-IZZNHLLZSA-N. The full InChI is InChI=1S/C26H31NO3/c1-2-28-20-26-25(30-19-21-9-4-3-5-10-21)18-27(15-16-29-26)17-23-13-8-12-22-11-6-7-14-24(22)23/h3-14,25-26H,2,15-20H2,1H3/t25-,26+/m0/s1.
What are the key properties of (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane?
(6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane has a molecular weight of 405.54 g/mol, XLogP of 4.66, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,7R)-7-(ethoxymethyl)-4-(naphthalen-1-ylmethyl)-6-phenylmethoxy-1,4-oxazepane is sourced from PubChem (CID 156549500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).