About 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide
2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide (PubChem CID 156549519) has the molecular formula C14H18N4O4S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 156549519 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccc(C)c(Nc2nc(C(=O)NS(=O)(=O)N(C)C)co2)c1 |
| InChI | InChI=1S/C14H18N4O4S/c1-9-5-6-10(2)11(7-9)15-14-16-12(8-22-14)13(19)17-23(20,21)18(3)4/h5-8H,1-4H3,(H,15,16)(H,17,19) |
| InChIKey | NTEZCNIXDVFCNP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide (CID 156549519) is 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide is Cc1ccc(C)c(Nc2nc(C(=O)NS(=O)(=O)N(C)C)co2)c1.
What is the InChIKey of 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide?
The InChIKey is NTEZCNIXDVFCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O4S/c1-9-5-6-10(2)11(7-9)15-14-16-12(8-22-14)13(19)17-23(20,21)18(3)4/h5-8H,1-4H3,(H,15,16)(H,17,19).
What are the key properties of 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide?
2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide has a molecular weight of 338.39 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylanilino)-N-(dimethylsulfamoyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 156549519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).