C18H22N4O4S — CID 156549528
N-(dimethylsulfamoyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3-oxazole-4-carboxamide (PubChem CID 156549528) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-(dimethylsulfamoyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(dimethylsulfamoyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 156549528 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-(dimethylsulfamoyl)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3-oxazole-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)NC(=O)c1coc(Nc2c3c(cc4c2CCC4)CCC3)n1 |
| InChI | InChI=1S/C18H22N4O4S/c1-22(2)27(24,25)21-17(23)15-10-26-18(19-15)20-16-13-7-3-5-11(13)9-12-6-4-8-14(12)16/h9-10H,3-8H2,1-2H3,(H,19,20)(H,21,23) |
| InChIKey | UYMHDPJPONYSQC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |