C18H19F3N4O5S — CID 156549707
N-[[(3aS,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]sulfonyl]-2-[2-methyl-5-(trifluoromethyl)anilino]-1,3-oxazole-4-carboxamide (PubChem CID 156549707) has the molecular formula C18H19F3N4O5S and a molecular weight of 460.43 g/mol. Its IUPAC name is N-[[(3aS,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]sulfonyl]-2-[2-methyl-5-(trifluoromethyl)anilino]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[[(3aS,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]sulfonyl]-2-[2-methyl-5-(trifluoromethyl)anilino]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 156549707 |
| Molecular Formula | C18H19F3N4O5S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | N-[[(3aS,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]sulfonyl]-2-[2-methyl-5-(trifluoromethyl)anilino]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccc(C(F)(F)F)cc1Nc1nc(C(=O)NS(=O)(=O)N2C[C@H]3COC[C@@H]3C2)co1 |
| InChI | InChI=1S/C18H19F3N4O5S/c1-10-2-3-13(18(19,20)21)4-14(10)22-17-23-15(9-30-17)16(26)24-31(27,28)25-5-11-7-29-8-12(11)6-25/h2-4,9,11-12H,5-8H2,1H3,(H,22,23)(H,24,26)/t11-,12-/m0/s1 |
| InChIKey | PJJPRLUAFYPLPW-RYUDHWBXSA-N |
| XLogP | 2.30 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |