About (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one
(7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one (PubChem CID 156550343) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one.
Molecular Properties
| Compound Name | (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one |
| PubChem CID | 156550343 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one |
| SMILES | C=C1C(=O)[C@](C)(O)C2(CC2)C1(C)CC |
| InChI | InChI=1S/C12H18O2/c1-5-10(3)8(2)9(13)11(4,14)12(10)6-7-12/h14H,2,5-7H2,1,3-4H3/t10?,11-/m0/s1 |
| InChIKey | QASPUZJSOMYIHI-DTIOYNMSSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one?
The IUPAC name of (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one (CID 156550343) is (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one.
What is the SMILES notation for (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one?
The canonical SMILES for (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one is C=C1C(=O)[C@](C)(O)C2(CC2)C1(C)CC.
What is the InChIKey of (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one?
The InChIKey is QASPUZJSOMYIHI-DTIOYNMSSA-N. The full InChI is InChI=1S/C12H18O2/c1-5-10(3)8(2)9(13)11(4,14)12(10)6-7-12/h14H,2,5-7H2,1,3-4H3/t10?,11-/m0/s1.
What are the key properties of (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one?
(7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one has a molecular weight of 194.27 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-4-ethyl-7-hydroxy-4,7-dimethyl-5-methylidenespiro[2.4]heptan-6-one is sourced from PubChem (CID 156550343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).