C17H22N2O4 — CID 156551077
4-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-2-methoxybenzamide (PubChem CID 156551077) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-2-methoxybenzamide.
| Compound Name | 4-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 156551077 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-tert-butyl-N-(2,6-dioxopiperidin-3-yl)-2-methoxybenzamide |
| SMILES | COc1cc(C(C)(C)C)ccc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H22N2O4/c1-17(2,3)10-5-6-11(13(9-10)23-4)15(21)18-12-7-8-14(20)19-16(12)22/h5-6,9,12H,7-8H2,1-4H3,(H,18,21)(H,19,20,22) |
| InChIKey | TVFHFIUDGMQUEG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|