About tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate
tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate (PubChem CID 156551552) has the molecular formula C20H25FN2O2
and a molecular weight of 344.43 g/mol. Its IUPAC name is tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate |
| PubChem CID | 156551552 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)Cc1ccc(F)c(-c2cccc(N)n2)c1 |
| InChI | InChI=1S/C20H25FN2O2/c1-19(2,3)25-18(24)20(4,5)12-13-9-10-15(21)14(11-13)16-7-6-8-17(22)23-16/h6-11H,12H2,1-5H3,(H2,22,23) |
| InChIKey | KUYMIXHQQMOXME-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate?
The IUPAC name of tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate (CID 156551552) is tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate.
What is the SMILES notation for tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate?
The canonical SMILES for tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate is CC(C)(C)OC(=O)C(C)(C)Cc1ccc(F)c(-c2cccc(N)n2)c1.
What is the InChIKey of tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate?
The InChIKey is KUYMIXHQQMOXME-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN2O2/c1-19(2,3)25-18(24)20(4,5)12-13-9-10-15(21)14(11-13)16-7-6-8-17(22)23-16/h6-11H,12H2,1-5H3,(H2,22,23).
What are the key properties of tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate?
tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate has a molecular weight of 344.43 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[3-(6-amino-2-pyridinyl)-4-fluorophenyl]-2,2-dimethylpropanoate is sourced from PubChem (CID 156551552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).