C57H36N4O — CID 156552056
14-[3-[3-[4-(2,4-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 156552056) has the molecular formula C57H36N4O and a molecular weight of 792.94 g/mol. Its IUPAC name is 14-[3-[3-[4-(2,4-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 14-[3-[3-[4-(2,4-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 156552056 |
| Molecular Formula | C57H36N4O |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | 14-[3-[3-[4-(2,4-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5cccc(-n6c7ccccc7c7c8c(ccc76)oc6ccccc68)c5)c4)n3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C57H36N4O/c1-4-16-37(17-5-1)42-30-31-45(48(36-42)38-18-6-2-7-19-38)57-59-55(39-20-8-3-9-21-39)58-56(60-57)43-24-14-22-40(34-43)41-23-15-25-44(35-41)61-49-28-12-10-26-46(49)53-50(61)32-33-52-54(53)47-27-11-13-29-51(47)62-52/h1-36H |
| InChIKey | YGBWECKHNGQKRA-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |