C22H16F2O3S — CID 156552238
1,1-difluoro-2-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethanesulfonic acid (PubChem CID 156552238) has the molecular formula C22H16F2O3S and a molecular weight of 398.43 g/mol. Its IUPAC name is 1,1-difluoro-2-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 156552238 |
| Molecular Formula | C22H16F2O3S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1,1-difluoro-2-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)CC12c3ccccc3C(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C22H16F2O3S/c23-22(24,28(25,26)27)13-21-17-10-4-1-7-14(17)20(15-8-2-5-11-18(15)21)16-9-3-6-12-19(16)21/h1-12,20H,13H2,(H,25,26,27) |
| InChIKey | ZNSOFBCDLKHHDR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|