About (3Z)-11-(methylamino)undeca-1,3-dien-6-ol
(3Z)-11-(methylamino)undeca-1,3-dien-6-ol (PubChem CID 156552309) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is (3Z)-11-(methylamino)undeca-1,3-dien-6-ol.
Molecular Properties
| Compound Name | (3Z)-11-(methylamino)undeca-1,3-dien-6-ol |
| PubChem CID | 156552309 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3Z)-11-(methylamino)undeca-1,3-dien-6-ol |
| SMILES | C=C/C=C\CC(O)CCCCCNC |
| InChI | InChI=1S/C12H23NO/c1-3-4-6-9-12(14)10-7-5-8-11-13-2/h3-4,6,12-14H,1,5,7-11H2,2H3/b6-4- |
| InChIKey | AGUFMWRJIQTQDZ-XQRVVYSFSA-N |
| XLogP | 2.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-11-(methylamino)undeca-1,3-dien-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-11-(methylamino)undeca-1,3-dien-6-ol?
The IUPAC name of (3Z)-11-(methylamino)undeca-1,3-dien-6-ol (CID 156552309) is (3Z)-11-(methylamino)undeca-1,3-dien-6-ol.
What is the SMILES notation for (3Z)-11-(methylamino)undeca-1,3-dien-6-ol?
The canonical SMILES for (3Z)-11-(methylamino)undeca-1,3-dien-6-ol is C=C/C=C\CC(O)CCCCCNC.
What is the InChIKey of (3Z)-11-(methylamino)undeca-1,3-dien-6-ol?
The InChIKey is AGUFMWRJIQTQDZ-XQRVVYSFSA-N. The full InChI is InChI=1S/C12H23NO/c1-3-4-6-9-12(14)10-7-5-8-11-13-2/h3-4,6,12-14H,1,5,7-11H2,2H3/b6-4-.
What are the key properties of (3Z)-11-(methylamino)undeca-1,3-dien-6-ol?
(3Z)-11-(methylamino)undeca-1,3-dien-6-ol has a molecular weight of 197.32 g/mol, XLogP of 2.26, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-11-(methylamino)undeca-1,3-dien-6-ol is sourced from PubChem (CID 156552309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).