About (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one
(2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one (PubChem CID 156552537) has the molecular formula C11H13FN2OS
and a molecular weight of 240.30 g/mol. Its IUPAC name is (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one |
| PubChem CID | 156552537 |
| Molecular Formula | C11H13FN2OS |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one |
| SMILES | C/N=C/[C@]1(c2scnc2F)CCCCC1=O |
| InChI | InChI=1S/C11H13FN2OS/c1-13-6-11(5-3-2-4-8(11)15)9-10(12)14-7-16-9/h6-7H,2-5H2,1H3/b13-6+/t11-/m1/s1 |
| InChIKey | WEYZIQZIYYVNGJ-XXLSNGBASA-N |
| XLogP | 2.36 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one?
The IUPAC name of (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one (CID 156552537) is (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one.
What is the SMILES notation for (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one?
The canonical SMILES for (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one is C/N=C/[C@]1(c2scnc2F)CCCCC1=O.
What is the InChIKey of (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one?
The InChIKey is WEYZIQZIYYVNGJ-XXLSNGBASA-N. The full InChI is InChI=1S/C11H13FN2OS/c1-13-6-11(5-3-2-4-8(11)15)9-10(12)14-7-16-9/h6-7H,2-5H2,1H3/b13-6+/t11-/m1/s1.
What are the key properties of (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one?
(2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one has a molecular weight of 240.30 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-fluoro-1,3-thiazol-5-yl)-2-(methyliminomethyl)cyclohexan-1-one is sourced from PubChem (CID 156552537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).