C11H7F5O — CID 15655332
2-methyl-4-(2,3,4,5,6-pentafluorophenyl)but-3-yn-2-ol (PubChem CID 15655332) has the molecular formula C11H7F5O and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-methyl-4-(2,3,4,5,6-pentafluorophenyl)but-3-yn-2-ol.
| Compound Name | 2-methyl-4-(2,3,4,5,6-pentafluorophenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 15655332 |
| Molecular Formula | C11H7F5O |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-methyl-4-(2,3,4,5,6-pentafluorophenyl)but-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H7F5O/c1-11(2,17)4-3-5-6(12)8(14)10(16)9(15)7(5)13/h17H,1-2H3 |
| InChIKey | NZJFDBGAZHTGNG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|