C15H9F7S — CID 15655347
1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-phenylbenzene (PubChem CID 15655347) has the molecular formula C15H9F7S and a molecular weight of 354.29 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-phenylbenzene.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-phenylbenzene |
|---|---|
| PubChem CID | 15655347 |
| Molecular Formula | C15H9F7S |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-phenylbenzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)Sc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C15H9F7S/c16-13(17,14(18,19)20)15(21,22)23-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | CAXRBWODZQAPBL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|