C17H30O6 — CID 156554510
2-[[(1S,3S,4R,5S,8R,12S,14R)-14-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]ethanol (PubChem CID 156554510) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-[[(1S,3S,4R,5S,8R,12S,14R)-14-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]ethanol.
| Compound Name | 2-[[(1S,3S,4R,5S,8R,12S,14R)-14-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]ethanol |
|---|---|
| PubChem CID | 156554510 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-[[(1S,3S,4R,5S,8R,12S,14R)-14-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxy]ethanol |
| SMILES | C[C@H]1[C@@H](OCCO)O[C@@H]2O[C@@H](C)CCC3[C@H](C)CC[C@@H]1[C@]32OO |
| InChI | InChI=1S/C17H30O6/c1-10-4-6-14-12(3)15(20-9-8-18)22-16-17(14,23-19)13(10)7-5-11(2)21-16/h10-16,18-19H,4-9H2,1-3H3/t10-,11+,12-,13?,14+,15+,16+,17-/m1/s1 |
| InChIKey | KHMFUJWQILDYBR-XRDDAUCQSA-N |
| XLogP | 2.40 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|