C12H24O4 — CID 156555309
(2-hydroxy-3-propan-2-yloxypropyl) 4-methylpentanoate (PubChem CID 156555309) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2-hydroxy-3-propan-2-yloxypropyl) 4-methylpentanoate.
| Compound Name | (2-hydroxy-3-propan-2-yloxypropyl) 4-methylpentanoate |
|---|---|
| PubChem CID | 156555309 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (2-hydroxy-3-propan-2-yloxypropyl) 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OCC(O)COC(C)C |
| InChI | InChI=1S/C12H24O4/c1-9(2)5-6-12(14)16-8-11(13)7-15-10(3)4/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | VZQDPZKUPHQDMG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |