C11H15NS — CID 156555710
(3aS,7aR)-N,4,7a-trimethyl-3aH-1-benzothiophen-3-imine (PubChem CID 156555710) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is (3aS,7aR)-N,4,7a-trimethyl-3aH-1-benzothiophen-3-imine.
| Compound Name | (3aS,7aR)-N,4,7a-trimethyl-3aH-1-benzothiophen-3-imine |
|---|---|
| PubChem CID | 156555710 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (3aS,7aR)-N,4,7a-trimethyl-3aH-1-benzothiophen-3-imine |
| SMILES | C/N=C1\CS[C@]2(C)C=CC=C(C)[C@@H]12 |
| InChI | InChI=1S/C11H15NS/c1-8-5-4-6-11(2)10(8)9(12-3)7-13-11/h4-6,10H,7H2,1-3H3/b12-9+/t10-,11+/m0/s1 |
| InChIKey | NDQVYYVEOWUDBN-OTLCKXBVSA-N |
| XLogP | 2.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|