About 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol
2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol (PubChem CID 156555745) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol.
Molecular Properties
| Compound Name | 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol |
| PubChem CID | 156555745 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol |
| SMILES | COc1nc(OC)c2c(n1)C(O)CC2 |
| InChI | InChI=1S/C9H12N2O3/c1-13-8-5-3-4-6(12)7(5)10-9(11-8)14-2/h6,12H,3-4H2,1-2H3 |
| InChIKey | UQEOGCURWQDMAA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol?
The IUPAC name of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol (CID 156555745) is 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol.
What is the SMILES notation for 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol?
The canonical SMILES for 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol is COc1nc(OC)c2c(n1)C(O)CC2.
What is the InChIKey of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol?
The InChIKey is UQEOGCURWQDMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-13-8-5-3-4-6(12)7(5)10-9(11-8)14-2/h6,12H,3-4H2,1-2H3.
What are the key properties of 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol?
2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol has a molecular weight of 196.21 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-7-ol is sourced from PubChem (CID 156555745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).